About 1-methyl-2-methylidene-5H-2λ4,1-benzothiazepine
1-methyl-2-methylidene-5H-2λ4,1-benzothiazepine (PubChem CID 59272602) has the molecular formula C11H13NS
and a molecular weight of 191.30 g/mol. Its IUPAC name is 1-methyl-2-methylidene-5H-2λ4,1-benzothiazepine.
Molecular Properties
| Compound Name | 1-methyl-2-methylidene-5H-2λ4,1-benzothiazepine |
| PubChem CID | 59272602 |
| Molecular Formula | C11H13NS |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 1-methyl-2-methylidene-5H-2λ4,1-benzothiazepine |
| SMILES | C=S1C=CCc2ccccc2N1C |
| InChI | InChI=1S/C11H13NS/c1-12-11-8-4-3-6-10(11)7-5-9-13(12)2/h3-6,8-9H,2,7H2,1H3 |
| InChIKey | IKJFNSKXODUZMV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-methylidene-5H-2λ4,1-benzothiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-methylidene-5H-2λ4,1-benzothiazepine?
The IUPAC name of 1-methyl-2-methylidene-5H-2λ4,1-benzothiazepine (CID 59272602) is 1-methyl-2-methylidene-5H-2λ4,1-benzothiazepine.
What is the SMILES notation for 1-methyl-2-methylidene-5H-2λ4,1-benzothiazepine?
The canonical SMILES for 1-methyl-2-methylidene-5H-2λ4,1-benzothiazepine is C=S1C=CCc2ccccc2N1C.
What is the InChIKey of 1-methyl-2-methylidene-5H-2λ4,1-benzothiazepine?
The InChIKey is IKJFNSKXODUZMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NS/c1-12-11-8-4-3-6-10(11)7-5-9-13(12)2/h3-6,8-9H,2,7H2,1H3.
What are the key properties of 1-methyl-2-methylidene-5H-2λ4,1-benzothiazepine?
1-methyl-2-methylidene-5H-2λ4,1-benzothiazepine has a molecular weight of 191.30 g/mol, XLogP of 2.81, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-methylidene-5H-2λ4,1-benzothiazepine is sourced from PubChem (CID 59272602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).