C28H18F3N5O — CID 59272738
(3E)-3-(1H-pyrrol-2-ylmethylidene)-6-[3-[3-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-5-yl]phenyl]-1H-indol-2-one (PubChem CID 59272738) has the molecular formula C28H18F3N5O and a molecular weight of 497.48 g/mol. Its IUPAC name is (3E)-3-(1H-pyrrol-2-ylmethylidene)-6-[3-[3-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-5-yl]phenyl]-1H-indol-2-one.
| Compound Name | (3E)-3-(1H-pyrrol-2-ylmethylidene)-6-[3-[3-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-5-yl]phenyl]-1H-indol-2-one |
|---|---|
| PubChem CID | 59272738 |
| Molecular Formula | C28H18F3N5O |
| Molecular Weight | 497.48 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | (3E)-3-(1H-pyrrol-2-ylmethylidene)-6-[3-[3-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-5-yl]phenyl]-1H-indol-2-one |
| SMILES | O=C1Nc2cc(-c3cccc(-c4nc(-c5cccc(C(F)(F)F)c5)n[nH]4)c3)ccc2/C1=C\c1ccc[nH]1 |
| InChI | InChI=1S/C28H18F3N5O/c29-28(30,31)20-7-2-6-19(13-20)26-34-25(35-36-26)18-5-1-4-16(12-18)17-9-10-22-23(15-21-8-3-11-32-21)27(37)33-24(22)14-17/h1-15,32H,(H,33,37)(H,34,35,36)/b23-15+ |
| InChIKey | AHEJBOLABDDGIS-HZHRSRAPSA-N |
| XLogP | 6.65 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.48 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|