About 4-bromo-1-(3,5-difluoro-4-phenylmethoxyphenyl)-6-isocyanoindazole
4-bromo-1-(3,5-difluoro-4-phenylmethoxyphenyl)-6-isocyanoindazole (PubChem CID 59272952) has the molecular formula C21H12BrF2N3O
and a molecular weight of 440.25 g/mol. Its IUPAC name is 4-bromo-1-(3,5-difluoro-4-phenylmethoxyphenyl)-6-isocyanoindazole.
Molecular Properties
| Compound Name | 4-bromo-1-(3,5-difluoro-4-phenylmethoxyphenyl)-6-isocyanoindazole |
| PubChem CID | 59272952 |
| Molecular Formula | C21H12BrF2N3O |
| Molecular Weight | 440.25 g/mol |
| Exact Mass | 439.01 |
| IUPAC Name | 4-bromo-1-(3,5-difluoro-4-phenylmethoxyphenyl)-6-isocyanoindazole |
| SMILES | [C-]#[N+]c1cc(Br)c2cnn(-c3cc(F)c(OCc4ccccc4)c(F)c3)c2c1 |
| InChI | InChI=1S/C21H12BrF2N3O/c1-25-14-7-17(22)16-11-26-27(20(16)8-14)15-9-18(23)21(19(24)10-15)28-12-13-5-3-2-4-6-13/h2-11H,12H2 |
| InChIKey | MIPMHEVMDBWSQC-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 31.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.25 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-1-(3,5-difluoro-4-phenylmethoxyphenyl)-6-isocyanoindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1-(3,5-difluoro-4-phenylmethoxyphenyl)-6-isocyanoindazole?
The IUPAC name of 4-bromo-1-(3,5-difluoro-4-phenylmethoxyphenyl)-6-isocyanoindazole (CID 59272952) is 4-bromo-1-(3,5-difluoro-4-phenylmethoxyphenyl)-6-isocyanoindazole.
What is the SMILES notation for 4-bromo-1-(3,5-difluoro-4-phenylmethoxyphenyl)-6-isocyanoindazole?
The canonical SMILES for 4-bromo-1-(3,5-difluoro-4-phenylmethoxyphenyl)-6-isocyanoindazole is [C-]#[N+]c1cc(Br)c2cnn(-c3cc(F)c(OCc4ccccc4)c(F)c3)c2c1.
What is the InChIKey of 4-bromo-1-(3,5-difluoro-4-phenylmethoxyphenyl)-6-isocyanoindazole?
The InChIKey is MIPMHEVMDBWSQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H12BrF2N3O/c1-25-14-7-17(22)16-11-26-27(20(16)8-14)15-9-18(23)21(19(24)10-15)28-12-13-5-3-2-4-6-13/h2-11H,12H2.
What are the key properties of 4-bromo-1-(3,5-difluoro-4-phenylmethoxyphenyl)-6-isocyanoindazole?
4-bromo-1-(3,5-difluoro-4-phenylmethoxyphenyl)-6-isocyanoindazole has a molecular weight of 440.25 g/mol, XLogP of 6.20, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1-(3,5-difluoro-4-phenylmethoxyphenyl)-6-isocyanoindazole is sourced from PubChem (CID 59272952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).