About tert-butyl (2S,3S)-3-hydroxy-2-methylpyrrolidine-1-carboxylate
tert-butyl (2S,3S)-3-hydroxy-2-methylpyrrolidine-1-carboxylate (PubChem CID 59273034) has the molecular formula C10H19NO3
and a molecular weight of 201.27 g/mol. Its IUPAC name is tert-butyl (2S,3S)-3-hydroxy-2-methylpyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2S,3S)-3-hydroxy-2-methylpyrrolidine-1-carboxylate |
| PubChem CID | 59273034 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | tert-butyl (2S,3S)-3-hydroxy-2-methylpyrrolidine-1-carboxylate |
| SMILES | C[C@H]1[C@@H](O)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H19NO3/c1-7-8(12)5-6-11(7)9(13)14-10(2,3)4/h7-8,12H,5-6H2,1-4H3/t7-,8-/m0/s1 |
| InChIKey | RLHMCXQTIPFLRQ-YUMQZZPRSA-N |
| XLogP | 1.38 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl (2S,3S)-3-hydroxy-2-methylpyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S,3S)-3-hydroxy-2-methylpyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (2S,3S)-3-hydroxy-2-methylpyrrolidine-1-carboxylate (CID 59273034) is tert-butyl (2S,3S)-3-hydroxy-2-methylpyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2S,3S)-3-hydroxy-2-methylpyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (2S,3S)-3-hydroxy-2-methylpyrrolidine-1-carboxylate is C[C@H]1[C@@H](O)CCN1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (2S,3S)-3-hydroxy-2-methylpyrrolidine-1-carboxylate?
The InChIKey is RLHMCXQTIPFLRQ-YUMQZZPRSA-N. The full InChI is InChI=1S/C10H19NO3/c1-7-8(12)5-6-11(7)9(13)14-10(2,3)4/h7-8,12H,5-6H2,1-4H3/t7-,8-/m0/s1.
What are the key properties of tert-butyl (2S,3S)-3-hydroxy-2-methylpyrrolidine-1-carboxylate?
tert-butyl (2S,3S)-3-hydroxy-2-methylpyrrolidine-1-carboxylate has a molecular weight of 201.27 g/mol, XLogP of 1.38, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S,3S)-3-hydroxy-2-methylpyrrolidine-1-carboxylate is sourced from PubChem (CID 59273034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).