About 2-chloro-4-[(2S,3S)-2,3-diethyl-3-hydroxypyrrolidin-1-yl]-3-methylbenzonitrile
2-chloro-4-[(2S,3S)-2,3-diethyl-3-hydroxypyrrolidin-1-yl]-3-methylbenzonitrile (PubChem CID 59273048) has the molecular formula C16H21ClN2O
and a molecular weight of 292.81 g/mol. Its IUPAC name is 2-chloro-4-[(2S,3S)-2,3-diethyl-3-hydroxypyrrolidin-1-yl]-3-methylbenzonitrile.
Molecular Properties
| Compound Name | 2-chloro-4-[(2S,3S)-2,3-diethyl-3-hydroxypyrrolidin-1-yl]-3-methylbenzonitrile |
| PubChem CID | 59273048 |
| Molecular Formula | C16H21ClN2O |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-chloro-4-[(2S,3S)-2,3-diethyl-3-hydroxypyrrolidin-1-yl]-3-methylbenzonitrile |
| SMILES | CC[C@@H]1N(c2ccc(C#N)c(Cl)c2C)CC[C@@]1(O)CC |
| InChI | InChI=1S/C16H21ClN2O/c1-4-14-16(20,5-2)8-9-19(14)13-7-6-12(10-18)15(17)11(13)3/h6-7,14,20H,4-5,8-9H2,1-3H3/t14-,16-/m0/s1 |
| InChIKey | MQUDYBTZFAAUMA-HOCLYGCPSA-N |
| XLogP | 3.65 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-4-[(2S,3S)-2,3-diethyl-3-hydroxypyrrolidin-1-yl]-3-methylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-[(2S,3S)-2,3-diethyl-3-hydroxypyrrolidin-1-yl]-3-methylbenzonitrile?
The IUPAC name of 2-chloro-4-[(2S,3S)-2,3-diethyl-3-hydroxypyrrolidin-1-yl]-3-methylbenzonitrile (CID 59273048) is 2-chloro-4-[(2S,3S)-2,3-diethyl-3-hydroxypyrrolidin-1-yl]-3-methylbenzonitrile.
What is the SMILES notation for 2-chloro-4-[(2S,3S)-2,3-diethyl-3-hydroxypyrrolidin-1-yl]-3-methylbenzonitrile?
The canonical SMILES for 2-chloro-4-[(2S,3S)-2,3-diethyl-3-hydroxypyrrolidin-1-yl]-3-methylbenzonitrile is CC[C@@H]1N(c2ccc(C#N)c(Cl)c2C)CC[C@@]1(O)CC.
What is the InChIKey of 2-chloro-4-[(2S,3S)-2,3-diethyl-3-hydroxypyrrolidin-1-yl]-3-methylbenzonitrile?
The InChIKey is MQUDYBTZFAAUMA-HOCLYGCPSA-N. The full InChI is InChI=1S/C16H21ClN2O/c1-4-14-16(20,5-2)8-9-19(14)13-7-6-12(10-18)15(17)11(13)3/h6-7,14,20H,4-5,8-9H2,1-3H3/t14-,16-/m0/s1.
What are the key properties of 2-chloro-4-[(2S,3S)-2,3-diethyl-3-hydroxypyrrolidin-1-yl]-3-methylbenzonitrile?
2-chloro-4-[(2S,3S)-2,3-diethyl-3-hydroxypyrrolidin-1-yl]-3-methylbenzonitrile has a molecular weight of 292.81 g/mol, XLogP of 3.65, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-[(2S,3S)-2,3-diethyl-3-hydroxypyrrolidin-1-yl]-3-methylbenzonitrile is sourced from PubChem (CID 59273048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).