C39H42Cl2N3O3Ru- — CID 59273388
1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;dichloro-[[5-(1,3-dioxoisoindol-2-yl)-2-propan-2-yloxyphenyl]methylidene]ruthenium (PubChem CID 59273388) has the molecular formula C39H42Cl2N3O3Ru- and a molecular weight of 772.76 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;dichloro-[[5-(1,3-dioxoisoindol-2-yl)-2-propan-2-yloxyphenyl]methylidene]ruthenium.
| Compound Name | 1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;dichloro-[[5-(1,3-dioxoisoindol-2-yl)-2-propan-2-yloxyphenyl]methylidene]ruthenium |
|---|---|
| PubChem CID | 59273388 |
| Molecular Formula | C39H42Cl2N3O3Ru- |
| Molecular Weight | 772.76 g/mol |
| Exact Mass | 772.17 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;dichloro-[[5-(1,3-dioxoisoindol-2-yl)-2-propan-2-yloxyphenyl]methylidene]ruthenium |
| SMILES | CC(C)Oc1ccc(N2C(=O)c3ccccc3C2=O)cc1C=[Ru](Cl)Cl.Cc1cc(C)c(N2[CH-]N(c3c(C)cc(C)cc3C)CC2)c(C)c1 |
| InChI | InChI=1S/C21H27N2.C18H15NO3.2ClH.Ru/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;1-11(2)22-16-9-8-13(10-12(16)3)19-17(20)14-6-4-5-7-15(14)18(19)21;;;/h9-13H,7-8H2,1-6H3;3-11H,1-2H3;2*1H;/q-1;;;;+2/p-2 |
| InChIKey | CKGWFRHVVIZKLJ-UHFFFAOYSA-L |
| XLogP | 9.33 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.76 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|