About [(4-hydroxyphenyl)-naphthalen-1-ylboranyl] 2,4-diaminobutanoate
[(4-hydroxyphenyl)-naphthalen-1-ylboranyl] 2,4-diaminobutanoate (PubChem CID 59273412) has the molecular formula C20H21BN2O3
and a molecular weight of 348.21 g/mol. Its IUPAC name is [(4-hydroxyphenyl)-naphthalen-1-ylboranyl] 2,4-diaminobutanoate.
Molecular Properties
| Compound Name | [(4-hydroxyphenyl)-naphthalen-1-ylboranyl] 2,4-diaminobutanoate |
| PubChem CID | 59273412 |
| Molecular Formula | C20H21BN2O3 |
| Molecular Weight | 348.21 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | [(4-hydroxyphenyl)-naphthalen-1-ylboranyl] 2,4-diaminobutanoate |
| SMILES | NCCC(N)C(=O)OB(c1ccc(O)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H21BN2O3/c22-13-12-19(23)20(25)26-21(15-8-10-16(24)11-9-15)18-7-3-5-14-4-1-2-6-17(14)18/h1-11,19,24H,12-13,22-23H2 |
| InChIKey | CBRFWXUOYAPFKP-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.21 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(4-hydroxyphenyl)-naphthalen-1-ylboranyl] 2,4-diaminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4-hydroxyphenyl)-naphthalen-1-ylboranyl] 2,4-diaminobutanoate?
The IUPAC name of [(4-hydroxyphenyl)-naphthalen-1-ylboranyl] 2,4-diaminobutanoate (CID 59273412) is [(4-hydroxyphenyl)-naphthalen-1-ylboranyl] 2,4-diaminobutanoate.
What is the SMILES notation for [(4-hydroxyphenyl)-naphthalen-1-ylboranyl] 2,4-diaminobutanoate?
The canonical SMILES for [(4-hydroxyphenyl)-naphthalen-1-ylboranyl] 2,4-diaminobutanoate is NCCC(N)C(=O)OB(c1ccc(O)cc1)c1cccc2ccccc12.
What is the InChIKey of [(4-hydroxyphenyl)-naphthalen-1-ylboranyl] 2,4-diaminobutanoate?
The InChIKey is CBRFWXUOYAPFKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21BN2O3/c22-13-12-19(23)20(25)26-21(15-8-10-16(24)11-9-15)18-7-3-5-14-4-1-2-6-17(14)18/h1-11,19,24H,12-13,22-23H2.
What are the key properties of [(4-hydroxyphenyl)-naphthalen-1-ylboranyl] 2,4-diaminobutanoate?
[(4-hydroxyphenyl)-naphthalen-1-ylboranyl] 2,4-diaminobutanoate has a molecular weight of 348.21 g/mol, XLogP of 0.87, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-hydroxyphenyl)-naphthalen-1-ylboranyl] 2,4-diaminobutanoate is sourced from PubChem (CID 59273412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).