About 2,4-bis(4-fluoro-2-pyridinyl)-6-(4-naphthalen-1-ylphenyl)-1,3,5-triazine
2,4-bis(4-fluoro-2-pyridinyl)-6-(4-naphthalen-1-ylphenyl)-1,3,5-triazine (PubChem CID 59273788) has the molecular formula C29H17F2N5
and a molecular weight of 473.49 g/mol. Its IUPAC name is 2,4-bis(4-fluoro-2-pyridinyl)-6-(4-naphthalen-1-ylphenyl)-1,3,5-triazine.
Molecular Properties
| Compound Name | 2,4-bis(4-fluoro-2-pyridinyl)-6-(4-naphthalen-1-ylphenyl)-1,3,5-triazine |
| PubChem CID | 59273788 |
| Molecular Formula | C29H17F2N5 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 2,4-bis(4-fluoro-2-pyridinyl)-6-(4-naphthalen-1-ylphenyl)-1,3,5-triazine |
| SMILES | Fc1ccnc(-c2nc(-c3ccc(-c4cccc5ccccc45)cc3)nc(-c3cc(F)ccn3)n2)c1 |
| InChI | InChI=1S/C29H17F2N5/c30-21-12-14-32-25(16-21)28-34-27(35-29(36-28)26-17-22(31)13-15-33-26)20-10-8-19(9-11-20)24-7-3-5-18-4-1-2-6-23(18)24/h1-17H |
| InChIKey | PKAZDHGBVSFSNL-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,4-bis(4-fluoro-2-pyridinyl)-6-(4-naphthalen-1-ylphenyl)-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis(4-fluoro-2-pyridinyl)-6-(4-naphthalen-1-ylphenyl)-1,3,5-triazine?
The IUPAC name of 2,4-bis(4-fluoro-2-pyridinyl)-6-(4-naphthalen-1-ylphenyl)-1,3,5-triazine (CID 59273788) is 2,4-bis(4-fluoro-2-pyridinyl)-6-(4-naphthalen-1-ylphenyl)-1,3,5-triazine.
What is the SMILES notation for 2,4-bis(4-fluoro-2-pyridinyl)-6-(4-naphthalen-1-ylphenyl)-1,3,5-triazine?
The canonical SMILES for 2,4-bis(4-fluoro-2-pyridinyl)-6-(4-naphthalen-1-ylphenyl)-1,3,5-triazine is Fc1ccnc(-c2nc(-c3ccc(-c4cccc5ccccc45)cc3)nc(-c3cc(F)ccn3)n2)c1.
What is the InChIKey of 2,4-bis(4-fluoro-2-pyridinyl)-6-(4-naphthalen-1-ylphenyl)-1,3,5-triazine?
The InChIKey is PKAZDHGBVSFSNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H17F2N5/c30-21-12-14-32-25(16-21)28-34-27(35-29(36-28)26-17-22(31)13-15-33-26)20-10-8-19(9-11-20)24-7-3-5-18-4-1-2-6-23(18)24/h1-17H.
What are the key properties of 2,4-bis(4-fluoro-2-pyridinyl)-6-(4-naphthalen-1-ylphenyl)-1,3,5-triazine?
2,4-bis(4-fluoro-2-pyridinyl)-6-(4-naphthalen-1-ylphenyl)-1,3,5-triazine has a molecular weight of 473.49 g/mol, XLogP of 6.76, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(4-fluoro-2-pyridinyl)-6-(4-naphthalen-1-ylphenyl)-1,3,5-triazine is sourced from PubChem (CID 59273788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).