About N,N'-bis(methoxymethyl)-N,N'-dimethylmethanediamine
N,N'-bis(methoxymethyl)-N,N'-dimethylmethanediamine (PubChem CID 59273823) has the molecular formula C7H18N2O2
and a molecular weight of 162.23 g/mol. Its IUPAC name is N,N'-bis(methoxymethyl)-N,N'-dimethylmethanediamine.
Molecular Properties
| Compound Name | N,N'-bis(methoxymethyl)-N,N'-dimethylmethanediamine |
| PubChem CID | 59273823 |
| Molecular Formula | C7H18N2O2 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | N,N'-bis(methoxymethyl)-N,N'-dimethylmethanediamine |
| SMILES | COCN(C)CN(C)COC |
| InChI | InChI=1S/C7H18N2O2/c1-8(6-10-3)5-9(2)7-11-4/h5-7H2,1-4H3 |
| InChIKey | XVTSDRKCWOQGIE-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis(methoxymethyl)-N,N'-dimethylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis(methoxymethyl)-N,N'-dimethylmethanediamine?
The IUPAC name of N,N'-bis(methoxymethyl)-N,N'-dimethylmethanediamine (CID 59273823) is N,N'-bis(methoxymethyl)-N,N'-dimethylmethanediamine.
What is the SMILES notation for N,N'-bis(methoxymethyl)-N,N'-dimethylmethanediamine?
The canonical SMILES for N,N'-bis(methoxymethyl)-N,N'-dimethylmethanediamine is COCN(C)CN(C)COC.
What is the InChIKey of N,N'-bis(methoxymethyl)-N,N'-dimethylmethanediamine?
The InChIKey is XVTSDRKCWOQGIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N2O2/c1-8(6-10-3)5-9(2)7-11-4/h5-7H2,1-4H3.
What are the key properties of N,N'-bis(methoxymethyl)-N,N'-dimethylmethanediamine?
N,N'-bis(methoxymethyl)-N,N'-dimethylmethanediamine has a molecular weight of 162.23 g/mol, XLogP of 0.02, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(methoxymethyl)-N,N'-dimethylmethanediamine is sourced from PubChem (CID 59273823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).