C15H18N4 — CID 59273932
2-N,2-N,7-trimethyl-9a,10-dihydrophenazine-2,8-diamine (PubChem CID 59273932) has the molecular formula C15H18N4 and a molecular weight of 254.34 g/mol. Its IUPAC name is 2-N,2-N,7-trimethyl-9a,10-dihydrophenazine-2,8-diamine.
| Compound Name | 2-N,2-N,7-trimethyl-9a,10-dihydrophenazine-2,8-diamine |
|---|---|
| PubChem CID | 59273932 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 2-N,2-N,7-trimethyl-9a,10-dihydrophenazine-2,8-diamine |
| SMILES | CC1=CC2=Nc3ccc(N(C)C)cc3NC2C=C1N |
| InChI | InChI=1S/C15H18N4/c1-9-6-13-15(8-11(9)16)18-14-7-10(19(2)3)4-5-12(14)17-13/h4-8,15,18H,16H2,1-3H3 |
| InChIKey | ZPUGGGRTDCUWFM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |