About CID 59274240
CID 59274240 (PubChem CID 59274240) has the molecular formula C6H10Cl
and a molecular weight of 117.60 g/mol.
Molecular Properties
| Compound Name | CID 59274240 |
| PubChem CID | 59274240 |
| Molecular Formula | C6H10Cl |
| Molecular Weight | 117.60 g/mol |
| Exact Mass | 117.05 |
| IUPAC Name | — |
| SMILES | CC1[CH]C(Cl)C1C |
| InChI | InChI=1S/C6H10Cl/c1-4-3-6(7)5(4)2/h3-6H,1-2H3 |
| InChIKey | FXGVWDUWIBLMPG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.60 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze CID 59274240 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59274240?
The IUPAC name of CID 59274240 (CID 59274240) is not available.
What is the SMILES notation for CID 59274240?
The canonical SMILES for CID 59274240 is CC1[CH]C(Cl)C1C.
What is the InChIKey of CID 59274240?
The InChIKey is FXGVWDUWIBLMPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10Cl/c1-4-3-6(7)5(4)2/h3-6H,1-2H3.
What are the key properties of CID 59274240?
CID 59274240 has a molecular weight of 117.60 g/mol, XLogP of 2.08, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59274240 is sourced from PubChem (CID 59274240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).