C20H19Cl2NO3 — CID 59274578
[2-(2,4-dichloroanilino)phenyl] 2,3,4-trimethyl-2,3-dihydrofuran-5-carboxylate (PubChem CID 59274578) has the molecular formula C20H19Cl2NO3 and a molecular weight of 392.28 g/mol. Its IUPAC name is [2-(2,4-dichloroanilino)phenyl] 2,3,4-trimethyl-2,3-dihydrofuran-5-carboxylate.
| Compound Name | [2-(2,4-dichloroanilino)phenyl] 2,3,4-trimethyl-2,3-dihydrofuran-5-carboxylate |
|---|---|
| PubChem CID | 59274578 |
| Molecular Formula | C20H19Cl2NO3 |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | [2-(2,4-dichloroanilino)phenyl] 2,3,4-trimethyl-2,3-dihydrofuran-5-carboxylate |
| SMILES | CC1=C(C(=O)Oc2ccccc2Nc2ccc(Cl)cc2Cl)OC(C)C1C |
| InChI | InChI=1S/C20H19Cl2NO3/c1-11-12(2)19(25-13(11)3)20(24)26-18-7-5-4-6-17(18)23-16-9-8-14(21)10-15(16)22/h4-11,13,23H,1-3H3 |
| InChIKey | IPWNZFIHIAMGBP-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|