C18H34OSi — CID 59274935
[(4S,7aR)-7a-prop-1-en-2-yl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 59274935) has the molecular formula C18H34OSi and a molecular weight of 294.56 g/mol. Its IUPAC name is [(4S,7aR)-7a-prop-1-en-2-yl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(4S,7aR)-7a-prop-1-en-2-yl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 59274935 |
| Molecular Formula | C18H34OSi |
| Molecular Weight | 294.56 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | [(4S,7aR)-7a-prop-1-en-2-yl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=C(C)[C@@]12CCCC1[C@@H](O[Si](C)(C)C(C)(C)C)CCC2 |
| InChI | InChI=1S/C18H34OSi/c1-14(2)18-12-8-10-15(18)16(11-9-13-18)19-20(6,7)17(3,4)5/h15-16H,1,8-13H2,2-7H3/t15?,16-,18-/m0/s1 |
| InChIKey | XKHLPNMDCNJSOT-YLGOGADGSA-N |
| XLogP | 5.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.56 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|