About 2H-indol-6-amine
2H-indol-6-amine (PubChem CID 59274943) has the molecular formula C8H8N2
and a molecular weight of 132.17 g/mol. Its IUPAC name is 2H-indol-6-amine.
Molecular Properties
| Compound Name | 2H-indol-6-amine |
| PubChem CID | 59274943 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 2H-indol-6-amine |
| SMILES | Nc1ccc2c(c1)=NCC=2 |
| InChI | InChI=1S/C8H8N2/c9-7-2-1-6-3-4-10-8(6)5-7/h1-3,5H,4,9H2 |
| InChIKey | CXHJYSZNWDCFBF-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2H-indol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-indol-6-amine?
The IUPAC name of 2H-indol-6-amine (CID 59274943) is 2H-indol-6-amine.
What is the SMILES notation for 2H-indol-6-amine?
The canonical SMILES for 2H-indol-6-amine is Nc1ccc2c(c1)=NCC=2.
What is the InChIKey of 2H-indol-6-amine?
The InChIKey is CXHJYSZNWDCFBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2/c9-7-2-1-6-3-4-10-8(6)5-7/h1-3,5H,4,9H2.
What are the key properties of 2H-indol-6-amine?
2H-indol-6-amine has a molecular weight of 132.17 g/mol, XLogP of -0.32, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-indol-6-amine is sourced from PubChem (CID 59274943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).