About 1-(2-amino-4-iodo-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone
1-(2-amino-4-iodo-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone (PubChem CID 59276057) has the molecular formula C8H9IN4O
and a molecular weight of 304.09 g/mol. Its IUPAC name is 1-(2-amino-4-iodo-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone.
Molecular Properties
| Compound Name | 1-(2-amino-4-iodo-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone |
| PubChem CID | 59276057 |
| Molecular Formula | C8H9IN4O |
| Molecular Weight | 304.09 g/mol |
| Exact Mass | 303.98 |
| IUPAC Name | 1-(2-amino-4-iodo-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone |
| SMILES | CC(=O)N1Cc2nc(N)nc(I)c2C1 |
| InChI | InChI=1S/C8H9IN4O/c1-4(14)13-2-5-6(3-13)11-8(10)12-7(5)9/h2-3H2,1H3,(H2,10,11,12) |
| InChIKey | NPURHGJCJFELOP-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.09 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-amino-4-iodo-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-amino-4-iodo-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone?
The IUPAC name of 1-(2-amino-4-iodo-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone (CID 59276057) is 1-(2-amino-4-iodo-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone.
What is the SMILES notation for 1-(2-amino-4-iodo-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone?
The canonical SMILES for 1-(2-amino-4-iodo-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone is CC(=O)N1Cc2nc(N)nc(I)c2C1.
What is the InChIKey of 1-(2-amino-4-iodo-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone?
The InChIKey is NPURHGJCJFELOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9IN4O/c1-4(14)13-2-5-6(3-13)11-8(10)12-7(5)9/h2-3H2,1H3,(H2,10,11,12).
What are the key properties of 1-(2-amino-4-iodo-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone?
1-(2-amino-4-iodo-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone has a molecular weight of 304.09 g/mol, XLogP of 0.53, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-amino-4-iodo-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)ethanone is sourced from PubChem (CID 59276057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).