C17H19N5 — CID 59276461
N-phenyl-5-piperidin-4-yl-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 59276461) has the molecular formula C17H19N5 and a molecular weight of 293.37 g/mol. Its IUPAC name is N-phenyl-5-piperidin-4-yl-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-phenyl-5-piperidin-4-yl-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 59276461 |
| Molecular Formula | C17H19N5 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N-phenyl-5-piperidin-4-yl-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | c1ccc(Nc2nc3cccc(C4CCNCC4)n3n2)cc1 |
| InChI | InChI=1S/C17H19N5/c1-2-5-14(6-3-1)19-17-20-16-8-4-7-15(22(16)21-17)13-9-11-18-12-10-13/h1-8,13,18H,9-12H2,(H,19,21) |
| InChIKey | HQHXRRZSHNZQSP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 54.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |