C19H15N5O2S — CID 59276492
1,1-dioxo-N-(5-phenyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-2,3-dihydro-1,2-benzothiazol-6-amine (PubChem CID 59276492) has the molecular formula C19H15N5O2S and a molecular weight of 377.43 g/mol. Its IUPAC name is 1,1-dioxo-N-(5-phenyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-2,3-dihydro-1,2-benzothiazol-6-amine.
| Compound Name | 1,1-dioxo-N-(5-phenyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-2,3-dihydro-1,2-benzothiazol-6-amine |
|---|---|
| PubChem CID | 59276492 |
| Molecular Formula | C19H15N5O2S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 1,1-dioxo-N-(5-phenyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-2,3-dihydro-1,2-benzothiazol-6-amine |
| SMILES | O=S1(=O)NCc2ccc(Nc3nc4cccc(-c5ccccc5)n4n3)cc21 |
| InChI | InChI=1S/C19H15N5O2S/c25-27(26)17-11-15(10-9-14(17)12-20-27)21-19-22-18-8-4-7-16(24(18)23-19)13-5-2-1-3-6-13/h1-11,20H,12H2,(H,21,23) |
| InChIKey | MKQUQDUMMLIMNX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 88.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |