C18H15N5 — CID 59276560
5-(4-aminophenyl)-N-phenyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 59276560) has the molecular formula C18H15N5 and a molecular weight of 301.35 g/mol. Its IUPAC name is 5-(4-aminophenyl)-N-phenyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 5-(4-aminophenyl)-N-phenyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 59276560 |
| Molecular Formula | C18H15N5 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 5-(4-aminophenyl)-N-phenyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Nc1ccc(-c2cccc3nc(Nc4ccccc4)nn23)cc1 |
| InChI | InChI=1S/C18H15N5/c19-14-11-9-13(10-12-14)16-7-4-8-17-21-18(22-23(16)17)20-15-5-2-1-3-6-15/h1-12H,19H2,(H,20,22) |
| InChIKey | ICOABOIYTFDQKN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|