About tert-butyl N-[6-(5-amino-2,3-dihydroindol-1-yl)pyridazin-3-yl]-N-[2-(dimethylamino)ethyl]carbamate
tert-butyl N-[6-(5-amino-2,3-dihydroindol-1-yl)pyridazin-3-yl]-N-[2-(dimethylamino)ethyl]carbamate (PubChem CID 59276818) has the molecular formula C21H30N6O2
and a molecular weight of 398.51 g/mol. Its IUPAC name is tert-butyl N-[6-(5-amino-2,3-dihydroindol-1-yl)pyridazin-3-yl]-N-[2-(dimethylamino)ethyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[6-(5-amino-2,3-dihydroindol-1-yl)pyridazin-3-yl]-N-[2-(dimethylamino)ethyl]carbamate |
| PubChem CID | 59276818 |
| Molecular Formula | C21H30N6O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | tert-butyl N-[6-(5-amino-2,3-dihydroindol-1-yl)pyridazin-3-yl]-N-[2-(dimethylamino)ethyl]carbamate |
| SMILES | CN(C)CCN(C(=O)OC(C)(C)C)c1ccc(N2CCc3cc(N)ccc32)nn1 |
| InChI | InChI=1S/C21H30N6O2/c1-21(2,3)29-20(28)27(13-12-25(4)5)19-9-8-18(23-24-19)26-11-10-15-14-16(22)6-7-17(15)26/h6-9,14H,10-13,22H2,1-5H3 |
| InChIKey | IQGSZIZRWHRZAL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[6-(5-amino-2,3-dihydroindol-1-yl)pyridazin-3-yl]-N-[2-(dimethylamino)ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[6-(5-amino-2,3-dihydroindol-1-yl)pyridazin-3-yl]-N-[2-(dimethylamino)ethyl]carbamate?
The IUPAC name of tert-butyl N-[6-(5-amino-2,3-dihydroindol-1-yl)pyridazin-3-yl]-N-[2-(dimethylamino)ethyl]carbamate (CID 59276818) is tert-butyl N-[6-(5-amino-2,3-dihydroindol-1-yl)pyridazin-3-yl]-N-[2-(dimethylamino)ethyl]carbamate.
What is the SMILES notation for tert-butyl N-[6-(5-amino-2,3-dihydroindol-1-yl)pyridazin-3-yl]-N-[2-(dimethylamino)ethyl]carbamate?
The canonical SMILES for tert-butyl N-[6-(5-amino-2,3-dihydroindol-1-yl)pyridazin-3-yl]-N-[2-(dimethylamino)ethyl]carbamate is CN(C)CCN(C(=O)OC(C)(C)C)c1ccc(N2CCc3cc(N)ccc32)nn1.
What is the InChIKey of tert-butyl N-[6-(5-amino-2,3-dihydroindol-1-yl)pyridazin-3-yl]-N-[2-(dimethylamino)ethyl]carbamate?
The InChIKey is IQGSZIZRWHRZAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30N6O2/c1-21(2,3)29-20(28)27(13-12-25(4)5)19-9-8-18(23-24-19)26-11-10-15-14-16(22)6-7-17(15)26/h6-9,14H,10-13,22H2,1-5H3.
What are the key properties of tert-butyl N-[6-(5-amino-2,3-dihydroindol-1-yl)pyridazin-3-yl]-N-[2-(dimethylamino)ethyl]carbamate?
tert-butyl N-[6-(5-amino-2,3-dihydroindol-1-yl)pyridazin-3-yl]-N-[2-(dimethylamino)ethyl]carbamate has a molecular weight of 398.51 g/mol, XLogP of 3.06, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[6-(5-amino-2,3-dihydroindol-1-yl)pyridazin-3-yl]-N-[2-(dimethylamino)ethyl]carbamate is sourced from PubChem (CID 59276818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).