About tert-butyl 2-[(3,5-dichlorophenyl)sulfonyl-[3-(trifluoromethyl)-1H-indol-5-yl]amino]acetate
tert-butyl 2-[(3,5-dichlorophenyl)sulfonyl-[3-(trifluoromethyl)-1H-indol-5-yl]amino]acetate (PubChem CID 59277427) has the molecular formula C21H19Cl2F3N2O4S
and a molecular weight of 523.36 g/mol. Its IUPAC name is tert-butyl 2-[(3,5-dichlorophenyl)sulfonyl-[3-(trifluoromethyl)-1H-indol-5-yl]amino]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[(3,5-dichlorophenyl)sulfonyl-[3-(trifluoromethyl)-1H-indol-5-yl]amino]acetate |
| PubChem CID | 59277427 |
| Molecular Formula | C21H19Cl2F3N2O4S |
| Molecular Weight | 523.36 g/mol |
| Exact Mass | 522.04 |
| IUPAC Name | tert-butyl 2-[(3,5-dichlorophenyl)sulfonyl-[3-(trifluoromethyl)-1H-indol-5-yl]amino]acetate |
| SMILES | CC(C)(C)OC(=O)CN(c1ccc2[nH]cc(C(F)(F)F)c2c1)S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C21H19Cl2F3N2O4S/c1-20(2,3)32-19(29)11-28(33(30,31)15-7-12(22)6-13(23)8-15)14-4-5-18-16(9-14)17(10-27-18)21(24,25)26/h4-10,27H,11H2,1-3H3 |
| InChIKey | ODVIYOPSUSDPBL-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 523.36 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 2-[(3,5-dichlorophenyl)sulfonyl-[3-(trifluoromethyl)-1H-indol-5-yl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[(3,5-dichlorophenyl)sulfonyl-[3-(trifluoromethyl)-1H-indol-5-yl]amino]acetate?
The IUPAC name of tert-butyl 2-[(3,5-dichlorophenyl)sulfonyl-[3-(trifluoromethyl)-1H-indol-5-yl]amino]acetate (CID 59277427) is tert-butyl 2-[(3,5-dichlorophenyl)sulfonyl-[3-(trifluoromethyl)-1H-indol-5-yl]amino]acetate.
What is the SMILES notation for tert-butyl 2-[(3,5-dichlorophenyl)sulfonyl-[3-(trifluoromethyl)-1H-indol-5-yl]amino]acetate?
The canonical SMILES for tert-butyl 2-[(3,5-dichlorophenyl)sulfonyl-[3-(trifluoromethyl)-1H-indol-5-yl]amino]acetate is CC(C)(C)OC(=O)CN(c1ccc2[nH]cc(C(F)(F)F)c2c1)S(=O)(=O)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of tert-butyl 2-[(3,5-dichlorophenyl)sulfonyl-[3-(trifluoromethyl)-1H-indol-5-yl]amino]acetate?
The InChIKey is ODVIYOPSUSDPBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19Cl2F3N2O4S/c1-20(2,3)32-19(29)11-28(33(30,31)15-7-12(22)6-13(23)8-15)14-4-5-18-16(9-14)17(10-27-18)21(24,25)26/h4-10,27H,11H2,1-3H3.
What are the key properties of tert-butyl 2-[(3,5-dichlorophenyl)sulfonyl-[3-(trifluoromethyl)-1H-indol-5-yl]amino]acetate?
tert-butyl 2-[(3,5-dichlorophenyl)sulfonyl-[3-(trifluoromethyl)-1H-indol-5-yl]amino]acetate has a molecular weight of 523.36 g/mol, XLogP of 6.03, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[(3,5-dichlorophenyl)sulfonyl-[3-(trifluoromethyl)-1H-indol-5-yl]amino]acetate is sourced from PubChem (CID 59277427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).