C23H25N5O2 — CID 59277609
(E)-N-methyl-N-[(2-methyl-1H-indol-3-yl)methyl]-3-(4-methyl-2-oxo-3,5-dihydro-1H-pyrido[2,3-e][1,4]diazepin-7-yl)prop-2-enamide (PubChem CID 59277609) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is (E)-N-methyl-N-[(2-methyl-1H-indol-3-yl)methyl]-3-(4-methyl-2-oxo-3,5-dihydro-1H-pyrido[2,3-e][1,4]diazepin-7-yl)prop-2-enamide.
| Compound Name | (E)-N-methyl-N-[(2-methyl-1H-indol-3-yl)methyl]-3-(4-methyl-2-oxo-3,5-dihydro-1H-pyrido[2,3-e][1,4]diazepin-7-yl)prop-2-enamide |
|---|---|
| PubChem CID | 59277609 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | (E)-N-methyl-N-[(2-methyl-1H-indol-3-yl)methyl]-3-(4-methyl-2-oxo-3,5-dihydro-1H-pyrido[2,3-e][1,4]diazepin-7-yl)prop-2-enamide |
| SMILES | Cc1[nH]c2ccccc2c1CN(C)C(=O)/C=C/c1cnc2c(c1)CN(C)CC(=O)N2 |
| InChI | InChI=1S/C23H25N5O2/c1-15-19(18-6-4-5-7-20(18)25-15)13-28(3)22(30)9-8-16-10-17-12-27(2)14-21(29)26-23(17)24-11-16/h4-11,25H,12-14H2,1-3H3,(H,24,26,29)/b9-8+ |
| InChIKey | GOPZAEKHLAQBDG-CMDGGOBGSA-N |
| XLogP | 2.93 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|