C28H30ClN5O2 — CID 59277729
(3S)-N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)-6,6-dimethyl-4-(1,2,3,4-tetrahydroisoquinolin-3-ylmethyl)morpholine-3-carboxamide (PubChem CID 59277729) has the molecular formula C28H30ClN5O2 and a molecular weight of 504.03 g/mol. Its IUPAC name is (3S)-N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)-6,6-dimethyl-4-(1,2,3,4-tetrahydroisoquinolin-3-ylmethyl)morpholine-3-carboxamide.
| Compound Name | (3S)-N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)-6,6-dimethyl-4-(1,2,3,4-tetrahydroisoquinolin-3-ylmethyl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 59277729 |
| Molecular Formula | C28H30ClN5O2 |
| Molecular Weight | 504.03 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | (3S)-N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)-6,6-dimethyl-4-(1,2,3,4-tetrahydroisoquinolin-3-ylmethyl)morpholine-3-carboxamide |
| SMILES | CC1(C)CN(CC2Cc3ccccc3CN2)[C@H](C(=O)Nc2cc(Cl)cc3c2[nH]c2cnccc23)CO1 |
| InChI | InChI=1S/C28H30ClN5O2/c1-28(2)16-34(14-20-9-17-5-3-4-6-18(17)12-31-20)25(15-36-28)27(35)33-23-11-19(29)10-22-21-7-8-30-13-24(21)32-26(22)23/h3-8,10-11,13,20,25,31-32H,9,12,14-16H2,1-2H3,(H,33,35)/t20?,25-/m0/s1 |
| InChIKey | FNQDDDYKTOSNKJ-KUXBLMNESA-N |
| XLogP | 4.50 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.03 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |