C30H39F3N4O4 — CID 59277980
(6R,9R,12S)-12-ethyl-9-propan-2-yl-6-[[3-(trifluoromethyl)phenyl]methyl]-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione (PubChem CID 59277980) has the molecular formula C30H39F3N4O4 and a molecular weight of 576.66 g/mol. Its IUPAC name is (6R,9R,12S)-12-ethyl-9-propan-2-yl-6-[[3-(trifluoromethyl)phenyl]methyl]-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione.
| Compound Name | (6R,9R,12S)-12-ethyl-9-propan-2-yl-6-[[3-(trifluoromethyl)phenyl]methyl]-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione |
|---|---|
| PubChem CID | 59277980 |
| Molecular Formula | C30H39F3N4O4 |
| Molecular Weight | 576.66 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | (6R,9R,12S)-12-ethyl-9-propan-2-yl-6-[[3-(trifluoromethyl)phenyl]methyl]-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione |
| SMILES | CC[C@@H]1NC(=O)[C@@H](C(C)C)NC(=O)[C@@H](Cc2cccc(C(F)(F)F)c2)NCCOc2ccccc2CCCNC1=O |
| InChI | InChI=1S/C30H39F3N4O4/c1-4-23-27(38)35-14-8-11-21-10-5-6-13-25(21)41-16-15-34-24(28(39)37-26(19(2)3)29(40)36-23)18-20-9-7-12-22(17-20)30(31,32)33/h5-7,9-10,12-13,17,19,23-24,26,34H,4,8,11,14-16,18H2,1-3H3,(H,35,38)(H,36,40)(H,37,39)/t23-,24+,26+/m0/s1 |
| InChIKey | OLHZYCXJFZQHSU-BFLUCZKCSA-N |
| XLogP | 3.38 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.66 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |