About (R)-N-[(1S)-2,2,2-trideuterio-1-(2-methylsulfonyl-4-pyridinyl)ethyl]methanesulfinamide
(R)-N-[(1S)-2,2,2-trideuterio-1-(2-methylsulfonyl-4-pyridinyl)ethyl]methanesulfinamide (PubChem CID 59278081) has the molecular formula C9H14N2O3S2
and a molecular weight of 265.37 g/mol. Its IUPAC name is (R)-N-[(1S)-2,2,2-trideuterio-1-(2-methylsulfonyl-4-pyridinyl)ethyl]methanesulfinamide.
Molecular Properties
| Compound Name | (R)-N-[(1S)-2,2,2-trideuterio-1-(2-methylsulfonyl-4-pyridinyl)ethyl]methanesulfinamide |
| PubChem CID | 59278081 |
| Molecular Formula | C9H14N2O3S2 |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | (R)-N-[(1S)-2,2,2-trideuterio-1-(2-methylsulfonyl-4-pyridinyl)ethyl]methanesulfinamide |
| SMILES | [2H]C([2H])([2H])[C@H](N[S@@](C)=O)c1ccnc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C9H14N2O3S2/c1-7(11-15(2)12)8-4-5-10-9(6-8)16(3,13)14/h4-7,11H,1-3H3/t7-,15+/m0/s1/i1D3 |
| InChIKey | MUVRVNXHPMVNQJ-WDKHXVDLSA-N |
| XLogP | 0.43 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (R)-N-[(1S)-2,2,2-trideuterio-1-(2-methylsulfonyl-4-pyridinyl)ethyl]methanesulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-N-[(1S)-2,2,2-trideuterio-1-(2-methylsulfonyl-4-pyridinyl)ethyl]methanesulfinamide?
The IUPAC name of (R)-N-[(1S)-2,2,2-trideuterio-1-(2-methylsulfonyl-4-pyridinyl)ethyl]methanesulfinamide (CID 59278081) is (R)-N-[(1S)-2,2,2-trideuterio-1-(2-methylsulfonyl-4-pyridinyl)ethyl]methanesulfinamide.
What is the SMILES notation for (R)-N-[(1S)-2,2,2-trideuterio-1-(2-methylsulfonyl-4-pyridinyl)ethyl]methanesulfinamide?
The canonical SMILES for (R)-N-[(1S)-2,2,2-trideuterio-1-(2-methylsulfonyl-4-pyridinyl)ethyl]methanesulfinamide is [2H]C([2H])([2H])[C@H](N[S@@](C)=O)c1ccnc(S(C)(=O)=O)c1.
What is the InChIKey of (R)-N-[(1S)-2,2,2-trideuterio-1-(2-methylsulfonyl-4-pyridinyl)ethyl]methanesulfinamide?
The InChIKey is MUVRVNXHPMVNQJ-WDKHXVDLSA-N. The full InChI is InChI=1S/C9H14N2O3S2/c1-7(11-15(2)12)8-4-5-10-9(6-8)16(3,13)14/h4-7,11H,1-3H3/t7-,15+/m0/s1/i1D3.
What are the key properties of (R)-N-[(1S)-2,2,2-trideuterio-1-(2-methylsulfonyl-4-pyridinyl)ethyl]methanesulfinamide?
(R)-N-[(1S)-2,2,2-trideuterio-1-(2-methylsulfonyl-4-pyridinyl)ethyl]methanesulfinamide has a molecular weight of 265.37 g/mol, XLogP of 0.43, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-N-[(1S)-2,2,2-trideuterio-1-(2-methylsulfonyl-4-pyridinyl)ethyl]methanesulfinamide is sourced from PubChem (CID 59278081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).