C23H19F4N5O6S2 — CID 59278225
[4-[(1S)-1-[[1-(4-fluorophenyl)pyrazolo[5,4-c]pyridine-4-carbonyl]amino]propyl]-6-methylsulfonyl-2-pyridinyl] trifluoromethanesulfonate (PubChem CID 59278225) has the molecular formula C23H19F4N5O6S2 and a molecular weight of 601.56 g/mol. Its IUPAC name is [4-[(1S)-1-[[1-(4-fluorophenyl)pyrazolo[5,4-c]pyridine-4-carbonyl]amino]propyl]-6-methylsulfonyl-2-pyridinyl] trifluoromethanesulfonate.
| Compound Name | [4-[(1S)-1-[[1-(4-fluorophenyl)pyrazolo[5,4-c]pyridine-4-carbonyl]amino]propyl]-6-methylsulfonyl-2-pyridinyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59278225 |
| Molecular Formula | C23H19F4N5O6S2 |
| Molecular Weight | 601.56 g/mol |
| Exact Mass | 601.07 |
| IUPAC Name | [4-[(1S)-1-[[1-(4-fluorophenyl)pyrazolo[5,4-c]pyridine-4-carbonyl]amino]propyl]-6-methylsulfonyl-2-pyridinyl] trifluoromethanesulfonate |
| SMILES | CC[C@H](NC(=O)c1cncc2c1cnn2-c1ccc(F)cc1)c1cc(OS(=O)(=O)C(F)(F)F)nc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C23H19F4N5O6S2/c1-3-18(13-8-20(31-21(9-13)39(2,34)35)38-40(36,37)23(25,26)27)30-22(33)17-10-28-12-19-16(17)11-29-32(19)15-6-4-14(24)5-7-15/h4-12,18H,3H2,1-2H3,(H,30,33)/t18-/m0/s1 |
| InChIKey | WUNLPKAAJRLTFI-SFHVURJKSA-N |
| XLogP | 3.47 |
| TPSA | 150.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|