C21H19N7O2S2 — CID 59278590
6-amino-4-[6-(2-hydroxyethoxy)-3-pyridinyl]-5-isocyano-2-[[2-(prop-2-enylamino)-1,3-thiazol-4-yl]methylsulfanyl]pyridine-3-carbonitrile (PubChem CID 59278590) has the molecular formula C21H19N7O2S2 and a molecular weight of 465.56 g/mol. Its IUPAC name is 6-amino-4-[6-(2-hydroxyethoxy)-3-pyridinyl]-5-isocyano-2-[[2-(prop-2-enylamino)-1,3-thiazol-4-yl]methylsulfanyl]pyridine-3-carbonitrile.
| Compound Name | 6-amino-4-[6-(2-hydroxyethoxy)-3-pyridinyl]-5-isocyano-2-[[2-(prop-2-enylamino)-1,3-thiazol-4-yl]methylsulfanyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 59278590 |
| Molecular Formula | C21H19N7O2S2 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 6-amino-4-[6-(2-hydroxyethoxy)-3-pyridinyl]-5-isocyano-2-[[2-(prop-2-enylamino)-1,3-thiazol-4-yl]methylsulfanyl]pyridine-3-carbonitrile |
| SMILES | [C-]#[N+]c1c(N)nc(SCc2csc(NCC=C)n2)c(C#N)c1-c1ccc(OCCO)nc1 |
| InChI | InChI=1S/C21H19N7O2S2/c1-3-6-25-21-27-14(12-32-21)11-31-20-15(9-22)17(18(24-2)19(23)28-20)13-4-5-16(26-10-13)30-8-7-29/h3-5,10,12,29H,1,6-8,11H2,(H2,23,28)(H,25,27) |
| InChIKey | VMDCRJKWEGUBPC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 134.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|