C22H26N2O4 — CID 59278786
4-[4-[(2-methoxy-5-methylphenyl)carbamoylamino]phenyl]cyclohexane-1-carboxylic acid (PubChem CID 59278786) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 4-[4-[(2-methoxy-5-methylphenyl)carbamoylamino]phenyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-[(2-methoxy-5-methylphenyl)carbamoylamino]phenyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 59278786 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 4-[4-[(2-methoxy-5-methylphenyl)carbamoylamino]phenyl]cyclohexane-1-carboxylic acid |
| SMILES | COc1ccc(C)cc1NC(=O)Nc1ccc(C2CCC(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C22H26N2O4/c1-14-3-12-20(28-2)19(13-14)24-22(27)23-18-10-8-16(9-11-18)15-4-6-17(7-5-15)21(25)26/h3,8-13,15,17H,4-7H2,1-2H3,(H,25,26)(H2,23,24,27) |
| InChIKey | GZUBDFMDQGFLLS-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |