About 7-ethyl-8,9,10-trimethyl-1-oxa-6-thiaspiro[4.5]decane
7-ethyl-8,9,10-trimethyl-1-oxa-6-thiaspiro[4.5]decane (PubChem CID 59278935) has the molecular formula C13H24OS
and a molecular weight of 228.40 g/mol. Its IUPAC name is 7-ethyl-8,9,10-trimethyl-1-oxa-6-thiaspiro[4.5]decane.
Molecular Properties
| Compound Name | 7-ethyl-8,9,10-trimethyl-1-oxa-6-thiaspiro[4.5]decane |
| PubChem CID | 59278935 |
| Molecular Formula | C13H24OS |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 7-ethyl-8,9,10-trimethyl-1-oxa-6-thiaspiro[4.5]decane |
| SMILES | CCC1SC2(CCCO2)C(C)C(C)C1C |
| InChI | InChI=1S/C13H24OS/c1-5-12-10(3)9(2)11(4)13(15-12)7-6-8-14-13/h9-12H,5-8H2,1-4H3 |
| InChIKey | HRFQVVNJCOCNFQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-ethyl-8,9,10-trimethyl-1-oxa-6-thiaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-8,9,10-trimethyl-1-oxa-6-thiaspiro[4.5]decane?
The IUPAC name of 7-ethyl-8,9,10-trimethyl-1-oxa-6-thiaspiro[4.5]decane (CID 59278935) is 7-ethyl-8,9,10-trimethyl-1-oxa-6-thiaspiro[4.5]decane.
What is the SMILES notation for 7-ethyl-8,9,10-trimethyl-1-oxa-6-thiaspiro[4.5]decane?
The canonical SMILES for 7-ethyl-8,9,10-trimethyl-1-oxa-6-thiaspiro[4.5]decane is CCC1SC2(CCCO2)C(C)C(C)C1C.
What is the InChIKey of 7-ethyl-8,9,10-trimethyl-1-oxa-6-thiaspiro[4.5]decane?
The InChIKey is HRFQVVNJCOCNFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24OS/c1-5-12-10(3)9(2)11(4)13(15-12)7-6-8-14-13/h9-12H,5-8H2,1-4H3.
What are the key properties of 7-ethyl-8,9,10-trimethyl-1-oxa-6-thiaspiro[4.5]decane?
7-ethyl-8,9,10-trimethyl-1-oxa-6-thiaspiro[4.5]decane has a molecular weight of 228.40 g/mol, XLogP of 3.93, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-8,9,10-trimethyl-1-oxa-6-thiaspiro[4.5]decane is sourced from PubChem (CID 59278935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).