C23H26O6S — CID 59278969
1-[4-[[(3S,3'R,4'S,5'S,6'R)-3',4',5'-trihydroxy-6'-(hydroxymethyl)-6-methylspiro[1H-2-benzofuran-3,2'-thiane]-5-yl]methyl]phenyl]ethanone (PubChem CID 59278969) has the molecular formula C23H26O6S and a molecular weight of 430.52 g/mol. Its IUPAC name is 1-[4-[[(3S,3'R,4'S,5'S,6'R)-3',4',5'-trihydroxy-6'-(hydroxymethyl)-6-methylspiro[1H-2-benzofuran-3,2'-thiane]-5-yl]methyl]phenyl]ethanone.
| Compound Name | 1-[4-[[(3S,3'R,4'S,5'S,6'R)-3',4',5'-trihydroxy-6'-(hydroxymethyl)-6-methylspiro[1H-2-benzofuran-3,2'-thiane]-5-yl]methyl]phenyl]ethanone |
|---|---|
| PubChem CID | 59278969 |
| Molecular Formula | C23H26O6S |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 1-[4-[[(3S,3'R,4'S,5'S,6'R)-3',4',5'-trihydroxy-6'-(hydroxymethyl)-6-methylspiro[1H-2-benzofuran-3,2'-thiane]-5-yl]methyl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(Cc2cc3c(cc2C)CO[C@]32S[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C23H26O6S/c1-12-7-17-11-29-23(22(28)21(27)20(26)19(10-24)30-23)18(17)9-16(12)8-14-3-5-15(6-4-14)13(2)25/h3-7,9,19-22,24,26-28H,8,10-11H2,1-2H3/t19-,20-,21+,22-,23+/m1/s1 |
| InChIKey | VFPGTLOKWGJYEF-ZQGJOIPISA-N |
| XLogP | 1.66 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |