C22H24F2O5S — CID 59278973
(3S,3'R,4'S,5'S,6'R)-5-[[4-(2,2-difluoroethyl)phenyl]methyl]-6'-(hydroxymethyl)spiro[1H-2-benzofuran-3,2'-thiane]-3',4',5'-triol (PubChem CID 59278973) has the molecular formula C22H24F2O5S and a molecular weight of 438.49 g/mol. Its IUPAC name is (3S,3'R,4'S,5'S,6'R)-5-[[4-(2,2-difluoroethyl)phenyl]methyl]-6'-(hydroxymethyl)spiro[1H-2-benzofuran-3,2'-thiane]-3',4',5'-triol.
| Compound Name | (3S,3'R,4'S,5'S,6'R)-5-[[4-(2,2-difluoroethyl)phenyl]methyl]-6'-(hydroxymethyl)spiro[1H-2-benzofuran-3,2'-thiane]-3',4',5'-triol |
|---|---|
| PubChem CID | 59278973 |
| Molecular Formula | C22H24F2O5S |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | (3S,3'R,4'S,5'S,6'R)-5-[[4-(2,2-difluoroethyl)phenyl]methyl]-6'-(hydroxymethyl)spiro[1H-2-benzofuran-3,2'-thiane]-3',4',5'-triol |
| SMILES | OC[C@H]1S[C@]2(OCc3ccc(Cc4ccc(CC(F)F)cc4)cc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H24F2O5S/c23-18(24)9-13-3-1-12(2-4-13)7-14-5-6-15-11-29-22(16(15)8-14)21(28)20(27)19(26)17(10-25)30-22/h1-6,8,17-21,25-28H,7,9-11H2/t17-,19-,20+,21-,22+/m1/s1 |
| InChIKey | VEGKHSXFRJGTJB-VOFPXKNKSA-N |
| XLogP | 1.96 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |