C21H21F3O5S — CID 59279036
(3S,3'R,4'S,5'S,6'R)-6'-(hydroxymethyl)-5-[[4-(trifluoromethyl)phenyl]methyl]spiro[1H-2-benzofuran-3,2'-thiane]-3',4',5'-triol (PubChem CID 59279036) has the molecular formula C21H21F3O5S and a molecular weight of 442.46 g/mol. Its IUPAC name is (3S,3'R,4'S,5'S,6'R)-6'-(hydroxymethyl)-5-[[4-(trifluoromethyl)phenyl]methyl]spiro[1H-2-benzofuran-3,2'-thiane]-3',4',5'-triol.
| Compound Name | (3S,3'R,4'S,5'S,6'R)-6'-(hydroxymethyl)-5-[[4-(trifluoromethyl)phenyl]methyl]spiro[1H-2-benzofuran-3,2'-thiane]-3',4',5'-triol |
|---|---|
| PubChem CID | 59279036 |
| Molecular Formula | C21H21F3O5S |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | (3S,3'R,4'S,5'S,6'R)-6'-(hydroxymethyl)-5-[[4-(trifluoromethyl)phenyl]methyl]spiro[1H-2-benzofuran-3,2'-thiane]-3',4',5'-triol |
| SMILES | OC[C@H]1S[C@]2(OCc3ccc(Cc4ccc(C(F)(F)F)cc4)cc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H21F3O5S/c22-21(23,24)14-5-2-11(3-6-14)7-12-1-4-13-10-29-20(15(13)8-12)19(28)18(27)17(26)16(9-25)30-20/h1-6,8,16-19,25-28H,7,9-10H2/t16-,17-,18+,19-,20+/m1/s1 |
| InChIKey | MTIJMMFDCUUVMP-OBKDMQGPSA-N |
| XLogP | 2.17 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |