About tert-butyl 4-(3-ethyl-2-methyl-4-oxo-1,3,9-triazaspiro[4.5]dec-1-en-9-yl)piperidine-1-carboxylate
tert-butyl 4-(3-ethyl-2-methyl-4-oxo-1,3,9-triazaspiro[4.5]dec-1-en-9-yl)piperidine-1-carboxylate (PubChem CID 59279681) has the molecular formula C20H34N4O3
and a molecular weight of 378.52 g/mol. Its IUPAC name is tert-butyl 4-(3-ethyl-2-methyl-4-oxo-1,3,9-triazaspiro[4.5]dec-1-en-9-yl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-(3-ethyl-2-methyl-4-oxo-1,3,9-triazaspiro[4.5]dec-1-en-9-yl)piperidine-1-carboxylate |
| PubChem CID | 59279681 |
| Molecular Formula | C20H34N4O3 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | tert-butyl 4-(3-ethyl-2-methyl-4-oxo-1,3,9-triazaspiro[4.5]dec-1-en-9-yl)piperidine-1-carboxylate |
| SMILES | CCN1C(=O)C2(CCCN(C3CCN(C(=O)OC(C)(C)C)CC3)C2)N=C1C |
| InChI | InChI=1S/C20H34N4O3/c1-6-24-15(2)21-20(17(24)25)10-7-11-23(14-20)16-8-12-22(13-9-16)18(26)27-19(3,4)5/h16H,6-14H2,1-5H3 |
| InChIKey | YPALVSPXSACYQW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 65.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 4-(3-ethyl-2-methyl-4-oxo-1,3,9-triazaspiro[4.5]dec-1-en-9-yl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(3-ethyl-2-methyl-4-oxo-1,3,9-triazaspiro[4.5]dec-1-en-9-yl)piperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-(3-ethyl-2-methyl-4-oxo-1,3,9-triazaspiro[4.5]dec-1-en-9-yl)piperidine-1-carboxylate (CID 59279681) is tert-butyl 4-(3-ethyl-2-methyl-4-oxo-1,3,9-triazaspiro[4.5]dec-1-en-9-yl)piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-(3-ethyl-2-methyl-4-oxo-1,3,9-triazaspiro[4.5]dec-1-en-9-yl)piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-(3-ethyl-2-methyl-4-oxo-1,3,9-triazaspiro[4.5]dec-1-en-9-yl)piperidine-1-carboxylate is CCN1C(=O)C2(CCCN(C3CCN(C(=O)OC(C)(C)C)CC3)C2)N=C1C.
What is the InChIKey of tert-butyl 4-(3-ethyl-2-methyl-4-oxo-1,3,9-triazaspiro[4.5]dec-1-en-9-yl)piperidine-1-carboxylate?
The InChIKey is YPALVSPXSACYQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34N4O3/c1-6-24-15(2)21-20(17(24)25)10-7-11-23(14-20)16-8-12-22(13-9-16)18(26)27-19(3,4)5/h16H,6-14H2,1-5H3.
What are the key properties of tert-butyl 4-(3-ethyl-2-methyl-4-oxo-1,3,9-triazaspiro[4.5]dec-1-en-9-yl)piperidine-1-carboxylate?
tert-butyl 4-(3-ethyl-2-methyl-4-oxo-1,3,9-triazaspiro[4.5]dec-1-en-9-yl)piperidine-1-carboxylate has a molecular weight of 378.52 g/mol, XLogP of 2.50, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(3-ethyl-2-methyl-4-oxo-1,3,9-triazaspiro[4.5]dec-1-en-9-yl)piperidine-1-carboxylate is sourced from PubChem (CID 59279681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).