About 2-methyl-4-(methylaminomethyl)-1,4-dihydroimidazol-5-one
2-methyl-4-(methylaminomethyl)-1,4-dihydroimidazol-5-one (PubChem CID 59279705) has the molecular formula C6H11N3O
and a molecular weight of 141.17 g/mol. Its IUPAC name is 2-methyl-4-(methylaminomethyl)-1,4-dihydroimidazol-5-one.
Molecular Properties
| Compound Name | 2-methyl-4-(methylaminomethyl)-1,4-dihydroimidazol-5-one |
| PubChem CID | 59279705 |
| Molecular Formula | C6H11N3O |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.09 |
| IUPAC Name | 2-methyl-4-(methylaminomethyl)-1,4-dihydroimidazol-5-one |
| SMILES | CNCC1N=C(C)NC1=O |
| InChI | InChI=1S/C6H11N3O/c1-4-8-5(3-7-2)6(10)9-4/h5,7H,3H2,1-2H3,(H,8,9,10) |
| InChIKey | LQXINJNSIYJJTP-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-4-(methylaminomethyl)-1,4-dihydroimidazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-(methylaminomethyl)-1,4-dihydroimidazol-5-one?
The IUPAC name of 2-methyl-4-(methylaminomethyl)-1,4-dihydroimidazol-5-one (CID 59279705) is 2-methyl-4-(methylaminomethyl)-1,4-dihydroimidazol-5-one.
What is the SMILES notation for 2-methyl-4-(methylaminomethyl)-1,4-dihydroimidazol-5-one?
The canonical SMILES for 2-methyl-4-(methylaminomethyl)-1,4-dihydroimidazol-5-one is CNCC1N=C(C)NC1=O.
What is the InChIKey of 2-methyl-4-(methylaminomethyl)-1,4-dihydroimidazol-5-one?
The InChIKey is LQXINJNSIYJJTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O/c1-4-8-5(3-7-2)6(10)9-4/h5,7H,3H2,1-2H3,(H,8,9,10).
What are the key properties of 2-methyl-4-(methylaminomethyl)-1,4-dihydroimidazol-5-one?
2-methyl-4-(methylaminomethyl)-1,4-dihydroimidazol-5-one has a molecular weight of 141.17 g/mol, XLogP of -0.88, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-(methylaminomethyl)-1,4-dihydroimidazol-5-one is sourced from PubChem (CID 59279705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).