C34H37F3N4O9S — CID 59280355
methyl (E,2S,6R)-7,7,7-trifluoro-6-[[(2S)-2-(methoxycarbonylamino)-3,3-diphenylpropanoyl]amino]-2-[(4-nitrophenyl)sulfonyl-propylamino]hept-4-enoate (PubChem CID 59280355) has the molecular formula C34H37F3N4O9S and a molecular weight of 734.75 g/mol. Its IUPAC name is methyl (E,2S,6R)-7,7,7-trifluoro-6-[[(2S)-2-(methoxycarbonylamino)-3,3-diphenylpropanoyl]amino]-2-[(4-nitrophenyl)sulfonyl-propylamino]hept-4-enoate.
| Compound Name | methyl (E,2S,6R)-7,7,7-trifluoro-6-[[(2S)-2-(methoxycarbonylamino)-3,3-diphenylpropanoyl]amino]-2-[(4-nitrophenyl)sulfonyl-propylamino]hept-4-enoate |
|---|---|
| PubChem CID | 59280355 |
| Molecular Formula | C34H37F3N4O9S |
| Molecular Weight | 734.75 g/mol |
| Exact Mass | 734.22 |
| IUPAC Name | methyl (E,2S,6R)-7,7,7-trifluoro-6-[[(2S)-2-(methoxycarbonylamino)-3,3-diphenylpropanoyl]amino]-2-[(4-nitrophenyl)sulfonyl-propylamino]hept-4-enoate |
| SMILES | CCCN([C@@H](C/C=C/[C@@H](NC(=O)[C@@H](NC(=O)OC)C(c1ccccc1)c1ccccc1)C(F)(F)F)C(=O)OC)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C34H37F3N4O9S/c1-4-22-40(51(47,48)26-20-18-25(19-21-26)41(45)46)27(32(43)49-2)16-11-17-28(34(35,36)37)38-31(42)30(39-33(44)50-3)29(23-12-7-5-8-13-23)24-14-9-6-10-15-24/h5-15,17-21,27-30H,4,16,22H2,1-3H3,(H,38,42)(H,39,44)/b17-11+/t27-,28+,30-/m0/s1 |
| InChIKey | JCZDYFZVYOSFFR-XIMIKMAMSA-N |
| XLogP | 5.09 |
| TPSA | 174.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.75 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|