C34H41F3N4O7S — CID 59280357
methyl (2S,6R)-2-[(4-aminophenyl)sulfonyl-propylamino]-7,7,7-trifluoro-6-[[(2S)-2-(methoxycarbonylamino)-3,3-diphenylpropanoyl]amino]heptanoate (PubChem CID 59280357) has the molecular formula C34H41F3N4O7S and a molecular weight of 706.78 g/mol. Its IUPAC name is methyl (2S,6R)-2-[(4-aminophenyl)sulfonyl-propylamino]-7,7,7-trifluoro-6-[[(2S)-2-(methoxycarbonylamino)-3,3-diphenylpropanoyl]amino]heptanoate.
| Compound Name | methyl (2S,6R)-2-[(4-aminophenyl)sulfonyl-propylamino]-7,7,7-trifluoro-6-[[(2S)-2-(methoxycarbonylamino)-3,3-diphenylpropanoyl]amino]heptanoate |
|---|---|
| PubChem CID | 59280357 |
| Molecular Formula | C34H41F3N4O7S |
| Molecular Weight | 706.78 g/mol |
| Exact Mass | 706.26 |
| IUPAC Name | methyl (2S,6R)-2-[(4-aminophenyl)sulfonyl-propylamino]-7,7,7-trifluoro-6-[[(2S)-2-(methoxycarbonylamino)-3,3-diphenylpropanoyl]amino]heptanoate |
| SMILES | CCCN([C@@H](CCC[C@@H](NC(=O)[C@@H](NC(=O)OC)C(c1ccccc1)c1ccccc1)C(F)(F)F)C(=O)OC)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C34H41F3N4O7S/c1-4-22-41(49(45,46)26-20-18-25(38)19-21-26)27(32(43)47-2)16-11-17-28(34(35,36)37)39-31(42)30(40-33(44)48-3)29(23-12-7-5-8-13-23)24-14-9-6-10-15-24/h5-10,12-15,18-21,27-30H,4,11,16-17,22,38H2,1-3H3,(H,39,42)(H,40,44)/t27-,28+,30-/m0/s1 |
| InChIKey | SAZYZTOTXBFUSM-LXQNXJGFSA-N |
| XLogP | 4.99 |
| TPSA | 157.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.78 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|