C36H46F3N3O7S — CID 59280375
methyl N-[(2S)-1-oxo-3,3-diphenyl-1-[[(2R,6S)-1,1,1-trifluoro-7-hydroxy-6-[[4-(hydroxymethyl)phenyl]sulfonyl-(3-methylbutyl)amino]heptan-2-yl]amino]propan-2-yl]carbamate (PubChem CID 59280375) has the molecular formula C36H46F3N3O7S and a molecular weight of 721.84 g/mol. Its IUPAC name is methyl N-[(2S)-1-oxo-3,3-diphenyl-1-[[(2R,6S)-1,1,1-trifluoro-7-hydroxy-6-[[4-(hydroxymethyl)phenyl]sulfonyl-(3-methylbutyl)amino]heptan-2-yl]amino]propan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-1-oxo-3,3-diphenyl-1-[[(2R,6S)-1,1,1-trifluoro-7-hydroxy-6-[[4-(hydroxymethyl)phenyl]sulfonyl-(3-methylbutyl)amino]heptan-2-yl]amino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 59280375 |
| Molecular Formula | C36H46F3N3O7S |
| Molecular Weight | 721.84 g/mol |
| Exact Mass | 721.30 |
| IUPAC Name | methyl N-[(2S)-1-oxo-3,3-diphenyl-1-[[(2R,6S)-1,1,1-trifluoro-7-hydroxy-6-[[4-(hydroxymethyl)phenyl]sulfonyl-(3-methylbutyl)amino]heptan-2-yl]amino]propan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N[C@H](CCC[C@@H](CO)N(CCC(C)C)S(=O)(=O)c1ccc(CO)cc1)C(F)(F)F)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H46F3N3O7S/c1-25(2)21-22-42(50(47,48)30-19-17-26(23-43)18-20-30)29(24-44)15-10-16-31(36(37,38)39)40-34(45)33(41-35(46)49-3)32(27-11-6-4-7-12-27)28-13-8-5-9-14-28/h4-9,11-14,17-20,25,29,31-33,43-44H,10,15-16,21-24H2,1-3H3,(H,40,45)(H,41,46)/t29-,31+,33-/m0/s1 |
| InChIKey | IWCVCHNCVIXQHM-VLDRXUDMSA-N |
| XLogP | 5.35 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.84 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |