C22H17F2N3O3 — CID 59280441
2-[2-[3-[(3R)-6,8-difluoro-3,4-dihydro-2H-chromen-3-yl]imidazol-4-yl]ethyl]isoindole-1,3-dione (PubChem CID 59280441) has the molecular formula C22H17F2N3O3 and a molecular weight of 409.39 g/mol. Its IUPAC name is 2-[2-[3-[(3R)-6,8-difluoro-3,4-dihydro-2H-chromen-3-yl]imidazol-4-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[3-[(3R)-6,8-difluoro-3,4-dihydro-2H-chromen-3-yl]imidazol-4-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 59280441 |
| Molecular Formula | C22H17F2N3O3 |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 2-[2-[3-[(3R)-6,8-difluoro-3,4-dihydro-2H-chromen-3-yl]imidazol-4-yl]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCc1cncn1[C@H]1COc2c(F)cc(F)cc2C1 |
| InChI | InChI=1S/C22H17F2N3O3/c23-14-7-13-8-16(11-30-20(13)19(24)9-14)27-12-25-10-15(27)5-6-26-21(28)17-3-1-2-4-18(17)22(26)29/h1-4,7,9-10,12,16H,5-6,8,11H2/t16-/m1/s1 |
| InChIKey | RGWQLYTWDKZGQW-MRXNPFEDSA-N |
| XLogP | 3.18 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|