About (2,4-dimethyl-1,3-thiazol-5-yl)sulfonyl-methanidylazanium
(2,4-dimethyl-1,3-thiazol-5-yl)sulfonyl-methanidylazanium (PubChem CID 59280638) has the molecular formula C6H10N2O2S2
and a molecular weight of 206.29 g/mol. Its IUPAC name is (2,4-dimethyl-1,3-thiazol-5-yl)sulfonyl-methanidylazanium.
Molecular Properties
| Compound Name | (2,4-dimethyl-1,3-thiazol-5-yl)sulfonyl-methanidylazanium |
| PubChem CID | 59280638 |
| Molecular Formula | C6H10N2O2S2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | (2,4-dimethyl-1,3-thiazol-5-yl)sulfonyl-methanidylazanium |
| SMILES | [CH2-][NH2+]S(=O)(=O)c1sc(C)nc1C |
| InChI | InChI=1S/C6H10N2O2S2/c1-4-6(11-5(2)8-4)12(9,10)7-3/h3,7H2,1-2H3 |
| InChIKey | DOEAPHDOWWRTPP-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 63.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dimethyl-1,3-thiazol-5-yl)sulfonyl-methanidylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dimethyl-1,3-thiazol-5-yl)sulfonyl-methanidylazanium?
The IUPAC name of (2,4-dimethyl-1,3-thiazol-5-yl)sulfonyl-methanidylazanium (CID 59280638) is (2,4-dimethyl-1,3-thiazol-5-yl)sulfonyl-methanidylazanium.
What is the SMILES notation for (2,4-dimethyl-1,3-thiazol-5-yl)sulfonyl-methanidylazanium?
The canonical SMILES for (2,4-dimethyl-1,3-thiazol-5-yl)sulfonyl-methanidylazanium is [CH2-][NH2+]S(=O)(=O)c1sc(C)nc1C.
What is the InChIKey of (2,4-dimethyl-1,3-thiazol-5-yl)sulfonyl-methanidylazanium?
The InChIKey is DOEAPHDOWWRTPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2S2/c1-4-6(11-5(2)8-4)12(9,10)7-3/h3,7H2,1-2H3.
What are the key properties of (2,4-dimethyl-1,3-thiazol-5-yl)sulfonyl-methanidylazanium?
(2,4-dimethyl-1,3-thiazol-5-yl)sulfonyl-methanidylazanium has a molecular weight of 206.29 g/mol, XLogP of -0.20, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dimethyl-1,3-thiazol-5-yl)sulfonyl-methanidylazanium is sourced from PubChem (CID 59280638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).