C21H18N2O2S2 — CID 59280778
[2-[[4-(benzenecarbonothioyl)-4,5-dihydro-1,3-oxazol-2-yl]methyl]-4,5-dihydro-1,3-oxazol-4-yl]-phenylmethanethione (PubChem CID 59280778) has the molecular formula C21H18N2O2S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is [2-[[4-(benzenecarbonothioyl)-4,5-dihydro-1,3-oxazol-2-yl]methyl]-4,5-dihydro-1,3-oxazol-4-yl]-phenylmethanethione.
| Compound Name | [2-[[4-(benzenecarbonothioyl)-4,5-dihydro-1,3-oxazol-2-yl]methyl]-4,5-dihydro-1,3-oxazol-4-yl]-phenylmethanethione |
|---|---|
| PubChem CID | 59280778 |
| Molecular Formula | C21H18N2O2S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | [2-[[4-(benzenecarbonothioyl)-4,5-dihydro-1,3-oxazol-2-yl]methyl]-4,5-dihydro-1,3-oxazol-4-yl]-phenylmethanethione |
| SMILES | S=C(c1ccccc1)C1COC(CC2=NC(C(=S)c3ccccc3)CO2)=N1 |
| InChI | InChI=1S/C21H18N2O2S2/c26-20(14-7-3-1-4-8-14)16-12-24-18(22-16)11-19-23-17(13-25-19)21(27)15-9-5-2-6-10-15/h1-10,16-17H,11-13H2 |
| InChIKey | RZNNPKDRVKKSTF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|