About (2S)-2-[(E)-3-methoxy-4,4-dimethylpent-1-enyl]-4-methyl-3,6-dihydro-2H-pyran
(2S)-2-[(E)-3-methoxy-4,4-dimethylpent-1-enyl]-4-methyl-3,6-dihydro-2H-pyran (PubChem CID 59280790) has the molecular formula C14H24O2
and a molecular weight of 224.34 g/mol. Its IUPAC name is (2S)-2-[(E)-3-methoxy-4,4-dimethylpent-1-enyl]-4-methyl-3,6-dihydro-2H-pyran.
Molecular Properties
| Compound Name | (2S)-2-[(E)-3-methoxy-4,4-dimethylpent-1-enyl]-4-methyl-3,6-dihydro-2H-pyran |
| PubChem CID | 59280790 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | (2S)-2-[(E)-3-methoxy-4,4-dimethylpent-1-enyl]-4-methyl-3,6-dihydro-2H-pyran |
| SMILES | COC(/C=C/[C@@H]1CC(C)=CCO1)C(C)(C)C |
| InChI | InChI=1S/C14H24O2/c1-11-8-9-16-12(10-11)6-7-13(15-5)14(2,3)4/h6-8,12-13H,9-10H2,1-5H3/b7-6+/t12-,13?/m1/s1 |
| InChIKey | HDCOIRCMQSNJAP-VXIIFPMOSA-N |
| XLogP | 3.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[(E)-3-methoxy-4,4-dimethylpent-1-enyl]-4-methyl-3,6-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(E)-3-methoxy-4,4-dimethylpent-1-enyl]-4-methyl-3,6-dihydro-2H-pyran?
The IUPAC name of (2S)-2-[(E)-3-methoxy-4,4-dimethylpent-1-enyl]-4-methyl-3,6-dihydro-2H-pyran (CID 59280790) is (2S)-2-[(E)-3-methoxy-4,4-dimethylpent-1-enyl]-4-methyl-3,6-dihydro-2H-pyran.
What is the SMILES notation for (2S)-2-[(E)-3-methoxy-4,4-dimethylpent-1-enyl]-4-methyl-3,6-dihydro-2H-pyran?
The canonical SMILES for (2S)-2-[(E)-3-methoxy-4,4-dimethylpent-1-enyl]-4-methyl-3,6-dihydro-2H-pyran is COC(/C=C/[C@@H]1CC(C)=CCO1)C(C)(C)C.
What is the InChIKey of (2S)-2-[(E)-3-methoxy-4,4-dimethylpent-1-enyl]-4-methyl-3,6-dihydro-2H-pyran?
The InChIKey is HDCOIRCMQSNJAP-VXIIFPMOSA-N. The full InChI is InChI=1S/C14H24O2/c1-11-8-9-16-12(10-11)6-7-13(15-5)14(2,3)4/h6-8,12-13H,9-10H2,1-5H3/b7-6+/t12-,13?/m1/s1.
What are the key properties of (2S)-2-[(E)-3-methoxy-4,4-dimethylpent-1-enyl]-4-methyl-3,6-dihydro-2H-pyran?
(2S)-2-[(E)-3-methoxy-4,4-dimethylpent-1-enyl]-4-methyl-3,6-dihydro-2H-pyran has a molecular weight of 224.34 g/mol, XLogP of 3.34, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(E)-3-methoxy-4,4-dimethylpent-1-enyl]-4-methyl-3,6-dihydro-2H-pyran is sourced from PubChem (CID 59280790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).