C15H18F3NOS — CID 59280933
N-[(E)-3-(3-butylsulfanylphenyl)prop-2-enyl]-2,2,2-trifluoroacetamide (PubChem CID 59280933) has the molecular formula C15H18F3NOS and a molecular weight of 317.38 g/mol. Its IUPAC name is N-[(E)-3-(3-butylsulfanylphenyl)prop-2-enyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(E)-3-(3-butylsulfanylphenyl)prop-2-enyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 59280933 |
| Molecular Formula | C15H18F3NOS |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | N-[(E)-3-(3-butylsulfanylphenyl)prop-2-enyl]-2,2,2-trifluoroacetamide |
| SMILES | CCCCSc1cccc(/C=C/CNC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C15H18F3NOS/c1-2-3-10-21-13-8-4-6-12(11-13)7-5-9-19-14(20)15(16,17)18/h4-8,11H,2-3,9-10H2,1H3,(H,19,20)/b7-5+ |
| InChIKey | ZNQUBZOUZSVEKU-FNORWQNLSA-N |
| XLogP | 4.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|