About 3-carboxypropyl-[2-(2,2-dimethylbutanoyloxy)ethyl]-dimethylazanium
3-carboxypropyl-[2-(2,2-dimethylbutanoyloxy)ethyl]-dimethylazanium (PubChem CID 59280965) has the molecular formula C14H28NO4+
and a molecular weight of 274.38 g/mol. Its IUPAC name is 3-carboxypropyl-[2-(2,2-dimethylbutanoyloxy)ethyl]-dimethylazanium.
Molecular Properties
| Compound Name | 3-carboxypropyl-[2-(2,2-dimethylbutanoyloxy)ethyl]-dimethylazanium |
| PubChem CID | 59280965 |
| Molecular Formula | C14H28NO4+ |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 3-carboxypropyl-[2-(2,2-dimethylbutanoyloxy)ethyl]-dimethylazanium |
| SMILES | CCC(C)(C)C(=O)OCC[N+](C)(C)CCCC(=O)O |
| InChI | InChI=1S/C14H27NO4/c1-6-14(2,3)13(18)19-11-10-15(4,5)9-7-8-12(16)17/h6-11H2,1-5H3/p+1 |
| InChIKey | WDVJSEXZHMZHIH-UHFFFAOYSA-O |
| XLogP | 1.91 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-carboxypropyl-[2-(2,2-dimethylbutanoyloxy)ethyl]-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-carboxypropyl-[2-(2,2-dimethylbutanoyloxy)ethyl]-dimethylazanium?
The IUPAC name of 3-carboxypropyl-[2-(2,2-dimethylbutanoyloxy)ethyl]-dimethylazanium (CID 59280965) is 3-carboxypropyl-[2-(2,2-dimethylbutanoyloxy)ethyl]-dimethylazanium.
What is the SMILES notation for 3-carboxypropyl-[2-(2,2-dimethylbutanoyloxy)ethyl]-dimethylazanium?
The canonical SMILES for 3-carboxypropyl-[2-(2,2-dimethylbutanoyloxy)ethyl]-dimethylazanium is CCC(C)(C)C(=O)OCC[N+](C)(C)CCCC(=O)O.
What is the InChIKey of 3-carboxypropyl-[2-(2,2-dimethylbutanoyloxy)ethyl]-dimethylazanium?
The InChIKey is WDVJSEXZHMZHIH-UHFFFAOYSA-O. The full InChI is InChI=1S/C14H27NO4/c1-6-14(2,3)13(18)19-11-10-15(4,5)9-7-8-12(16)17/h6-11H2,1-5H3/p+1.
What are the key properties of 3-carboxypropyl-[2-(2,2-dimethylbutanoyloxy)ethyl]-dimethylazanium?
3-carboxypropyl-[2-(2,2-dimethylbutanoyloxy)ethyl]-dimethylazanium has a molecular weight of 274.38 g/mol, XLogP of 1.91, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-carboxypropyl-[2-(2,2-dimethylbutanoyloxy)ethyl]-dimethylazanium is sourced from PubChem (CID 59280965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).