About 2-[5-(4-fluorophenyl)-3-methylpyrazol-1-yl]ethane-1,1-diol
2-[5-(4-fluorophenyl)-3-methylpyrazol-1-yl]ethane-1,1-diol (PubChem CID 59281563) has the molecular formula C12H13FN2O2
and a molecular weight of 236.25 g/mol. Its IUPAC name is 2-[5-(4-fluorophenyl)-3-methylpyrazol-1-yl]ethane-1,1-diol.
Molecular Properties
| Compound Name | 2-[5-(4-fluorophenyl)-3-methylpyrazol-1-yl]ethane-1,1-diol |
| PubChem CID | 59281563 |
| Molecular Formula | C12H13FN2O2 |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2-[5-(4-fluorophenyl)-3-methylpyrazol-1-yl]ethane-1,1-diol |
| SMILES | Cc1cc(-c2ccc(F)cc2)n(CC(O)O)n1 |
| InChI | InChI=1S/C12H13FN2O2/c1-8-6-11(15(14-8)7-12(16)17)9-2-4-10(13)5-3-9/h2-6,12,16-17H,7H2,1H3 |
| InChIKey | AOGMMJSPRZPBNG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(4-fluorophenyl)-3-methylpyrazol-1-yl]ethane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(4-fluorophenyl)-3-methylpyrazol-1-yl]ethane-1,1-diol?
The IUPAC name of 2-[5-(4-fluorophenyl)-3-methylpyrazol-1-yl]ethane-1,1-diol (CID 59281563) is 2-[5-(4-fluorophenyl)-3-methylpyrazol-1-yl]ethane-1,1-diol.
What is the SMILES notation for 2-[5-(4-fluorophenyl)-3-methylpyrazol-1-yl]ethane-1,1-diol?
The canonical SMILES for 2-[5-(4-fluorophenyl)-3-methylpyrazol-1-yl]ethane-1,1-diol is Cc1cc(-c2ccc(F)cc2)n(CC(O)O)n1.
What is the InChIKey of 2-[5-(4-fluorophenyl)-3-methylpyrazol-1-yl]ethane-1,1-diol?
The InChIKey is AOGMMJSPRZPBNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FN2O2/c1-8-6-11(15(14-8)7-12(16)17)9-2-4-10(13)5-3-9/h2-6,12,16-17H,7H2,1H3.
What are the key properties of 2-[5-(4-fluorophenyl)-3-methylpyrazol-1-yl]ethane-1,1-diol?
2-[5-(4-fluorophenyl)-3-methylpyrazol-1-yl]ethane-1,1-diol has a molecular weight of 236.25 g/mol, XLogP of 1.31, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(4-fluorophenyl)-3-methylpyrazol-1-yl]ethane-1,1-diol is sourced from PubChem (CID 59281563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).