About bis(1H-indazole);tetrachlororuthenium
bis(1H-indazole);tetrachlororuthenium (PubChem CID 59281622) has the molecular formula C14H12Cl4N4Ru
and a molecular weight of 479.16 g/mol. Its IUPAC name is bis(1H-indazole);tetrachlororuthenium.
Molecular Properties
| Compound Name | bis(1H-indazole);tetrachlororuthenium |
| PubChem CID | 59281622 |
| Molecular Formula | C14H12Cl4N4Ru |
| Molecular Weight | 479.16 g/mol |
| Exact Mass | 477.89 |
| IUPAC Name | bis(1H-indazole);tetrachlororuthenium |
| SMILES | Cl[Ru](Cl)(Cl)Cl.c1ccc2[nH]ncc2c1.c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/2C7H6N2.4ClH.Ru/c2*1-2-4-7-6(3-1)5-8-9-7;;;;;/h2*1-5H,(H,8,9);4*1H;/q;;;;;;+4/p-4 |
| InChIKey | SIHKLNQDIVPAOH-UHFFFAOYSA-J |
| XLogP | 5.88 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.16 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(1H-indazole);tetrachlororuthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1H-indazole);tetrachlororuthenium?
The IUPAC name of bis(1H-indazole);tetrachlororuthenium (CID 59281622) is bis(1H-indazole);tetrachlororuthenium.
What is the SMILES notation for bis(1H-indazole);tetrachlororuthenium?
The canonical SMILES for bis(1H-indazole);tetrachlororuthenium is Cl[Ru](Cl)(Cl)Cl.c1ccc2[nH]ncc2c1.c1ccc2[nH]ncc2c1.
What is the InChIKey of bis(1H-indazole);tetrachlororuthenium?
The InChIKey is SIHKLNQDIVPAOH-UHFFFAOYSA-J. The full InChI is InChI=1S/2C7H6N2.4ClH.Ru/c2*1-2-4-7-6(3-1)5-8-9-7;;;;;/h2*1-5H,(H,8,9);4*1H;/q;;;;;;+4/p-4.
What are the key properties of bis(1H-indazole);tetrachlororuthenium?
bis(1H-indazole);tetrachlororuthenium has a molecular weight of 479.16 g/mol, XLogP of 5.88, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1H-indazole);tetrachlororuthenium is sourced from PubChem (CID 59281622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).