C22H33N7O6 — CID 59281655
3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]ethylamino]ethylamino]ethyl]propanamide (PubChem CID 59281655) has the molecular formula C22H33N7O6 and a molecular weight of 491.55 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]ethylamino]ethylamino]ethyl]propanamide.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]ethylamino]ethylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 59281655 |
| Molecular Formula | C22H33N7O6 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]ethylamino]ethylamino]ethyl]propanamide |
| SMILES | O=C(CCN1C(=O)C=CC1=O)NCCNCCNCCNCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C22H33N7O6/c30-17(5-15-28-19(32)1-2-20(28)33)26-13-11-24-9-7-23-8-10-25-12-14-27-18(31)6-16-29-21(34)3-4-22(29)35/h1-4,23-25H,5-16H2,(H,26,30)(H,27,31) |
| InChIKey | DXOXXMIEIJZGFG-UHFFFAOYSA-N |
| XLogP | -3.38 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|