C27H33N7O9 — CID 59281656
N-[2-[bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]amino]ethyl]-3-(2,5-dioxopyrrol-1-yl)propanamide (PubChem CID 59281656) has the molecular formula C27H33N7O9 and a molecular weight of 599.60 g/mol. Its IUPAC name is N-[2-[bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]amino]ethyl]-3-(2,5-dioxopyrrol-1-yl)propanamide.
| Compound Name | N-[2-[bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]amino]ethyl]-3-(2,5-dioxopyrrol-1-yl)propanamide |
|---|---|
| PubChem CID | 59281656 |
| Molecular Formula | C27H33N7O9 |
| Molecular Weight | 599.60 g/mol |
| Exact Mass | 599.23 |
| IUPAC Name | N-[2-[bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]amino]ethyl]-3-(2,5-dioxopyrrol-1-yl)propanamide |
| SMILES | O=C(CCN1C(=O)C=CC1=O)NCCN(CCNC(=O)CCN1C(=O)C=CC1=O)CCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C27H33N7O9/c35-19(7-13-32-22(38)1-2-23(32)39)28-10-16-31(17-11-29-20(36)8-14-33-24(40)3-4-25(33)41)18-12-30-21(37)9-15-34-26(42)5-6-27(34)43/h1-6H,7-18H2,(H,28,35)(H,29,36)(H,30,37) |
| InChIKey | TWVPVQYDIYFYRO-UHFFFAOYSA-N |
| XLogP | -3.42 |
| TPSA | 202.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.60 |
| LogP ≤ 5 | -3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|