C33H45N7O9 — CID 59281659
N-[2-[bis[2-[3-(3-methylidene-2,5-dioxopyrrolidin-1-yl)butanoylamino]ethyl]amino]ethyl]-3-(3-methylidene-2,5-dioxopyrrolidin-1-yl)butanamide (PubChem CID 59281659) has the molecular formula C33H45N7O9 and a molecular weight of 683.76 g/mol. Its IUPAC name is N-[2-[bis[2-[3-(3-methylidene-2,5-dioxopyrrolidin-1-yl)butanoylamino]ethyl]amino]ethyl]-3-(3-methylidene-2,5-dioxopyrrolidin-1-yl)butanamide.
| Compound Name | N-[2-[bis[2-[3-(3-methylidene-2,5-dioxopyrrolidin-1-yl)butanoylamino]ethyl]amino]ethyl]-3-(3-methylidene-2,5-dioxopyrrolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 59281659 |
| Molecular Formula | C33H45N7O9 |
| Molecular Weight | 683.76 g/mol |
| Exact Mass | 683.33 |
| IUPAC Name | N-[2-[bis[2-[3-(3-methylidene-2,5-dioxopyrrolidin-1-yl)butanoylamino]ethyl]amino]ethyl]-3-(3-methylidene-2,5-dioxopyrrolidin-1-yl)butanamide |
| SMILES | C=C1CC(=O)N(C(C)CC(=O)NCCN(CCNC(=O)CC(C)N2C(=O)CC(=C)C2=O)CCNC(=O)CC(C)N2C(=O)CC(=C)C2=O)C1=O |
| InChI | InChI=1S/C33H45N7O9/c1-19-13-28(44)38(31(19)47)22(4)16-25(41)34-7-10-37(11-8-35-26(42)17-23(5)39-29(45)14-20(2)32(39)48)12-9-36-27(43)18-24(6)40-30(46)15-21(3)33(40)49/h22-24H,1-3,7-18H2,4-6H3,(H,34,41)(H,35,42)(H,36,43) |
| InChIKey | VDCBEHOPECDOQK-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 202.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.76 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|