C30H39N7O9 — CID 59281661
N-[2-[bis[2-[3-(3-methylidene-2,5-dioxopyrrolidin-1-yl)propanoylamino]ethyl]amino]ethyl]-3-(3-methylidene-2,5-dioxopyrrolidin-1-yl)propanamide (PubChem CID 59281661) has the molecular formula C30H39N7O9 and a molecular weight of 641.68 g/mol. Its IUPAC name is N-[2-[bis[2-[3-(3-methylidene-2,5-dioxopyrrolidin-1-yl)propanoylamino]ethyl]amino]ethyl]-3-(3-methylidene-2,5-dioxopyrrolidin-1-yl)propanamide.
| Compound Name | N-[2-[bis[2-[3-(3-methylidene-2,5-dioxopyrrolidin-1-yl)propanoylamino]ethyl]amino]ethyl]-3-(3-methylidene-2,5-dioxopyrrolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 59281661 |
| Molecular Formula | C30H39N7O9 |
| Molecular Weight | 641.68 g/mol |
| Exact Mass | 641.28 |
| IUPAC Name | N-[2-[bis[2-[3-(3-methylidene-2,5-dioxopyrrolidin-1-yl)propanoylamino]ethyl]amino]ethyl]-3-(3-methylidene-2,5-dioxopyrrolidin-1-yl)propanamide |
| SMILES | C=C1CC(=O)N(CCC(=O)NCCN(CCNC(=O)CCN2C(=O)CC(=C)C2=O)CCNC(=O)CCN2C(=O)CC(=C)C2=O)C1=O |
| InChI | InChI=1S/C30H39N7O9/c1-19-16-25(41)35(28(19)44)10-4-22(38)31-7-13-34(14-8-32-23(39)5-11-36-26(42)17-20(2)29(36)45)15-9-33-24(40)6-12-37-27(43)18-21(3)30(37)46/h1-18H2,(H,31,38)(H,32,39)(H,33,40) |
| InChIKey | LIOIYKKQRVPISS-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 202.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.68 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|