About 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-6-ethyl-2-methoxy-3,4,5-trimethyloxane
2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-6-ethyl-2-methoxy-3,4,5-trimethyloxane (PubChem CID 59281662) has the molecular formula C26H31FO2S
and a molecular weight of 426.60 g/mol. Its IUPAC name is 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-6-ethyl-2-methoxy-3,4,5-trimethyloxane.
Molecular Properties
| Compound Name | 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-6-ethyl-2-methoxy-3,4,5-trimethyloxane |
| PubChem CID | 59281662 |
| Molecular Formula | C26H31FO2S |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-6-ethyl-2-methoxy-3,4,5-trimethyloxane |
| SMILES | CCC1OC(OC)(c2ccc(F)c(Cc3cc4ccccc4s3)c2)C(C)C(C)C1C |
| InChI | InChI=1S/C26H31FO2S/c1-6-24-17(3)16(2)18(4)26(28-5,29-24)21-11-12-23(27)20(13-21)15-22-14-19-9-7-8-10-25(19)30-22/h7-14,16-18,24H,6,15H2,1-5H3 |
| InChIKey | HQIYTCVZQKPZPE-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-6-ethyl-2-methoxy-3,4,5-trimethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-6-ethyl-2-methoxy-3,4,5-trimethyloxane?
The IUPAC name of 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-6-ethyl-2-methoxy-3,4,5-trimethyloxane (CID 59281662) is 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-6-ethyl-2-methoxy-3,4,5-trimethyloxane.
What is the SMILES notation for 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-6-ethyl-2-methoxy-3,4,5-trimethyloxane?
The canonical SMILES for 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-6-ethyl-2-methoxy-3,4,5-trimethyloxane is CCC1OC(OC)(c2ccc(F)c(Cc3cc4ccccc4s3)c2)C(C)C(C)C1C.
What is the InChIKey of 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-6-ethyl-2-methoxy-3,4,5-trimethyloxane?
The InChIKey is HQIYTCVZQKPZPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H31FO2S/c1-6-24-17(3)16(2)18(4)26(28-5,29-24)21-11-12-23(27)20(13-21)15-22-14-19-9-7-8-10-25(19)30-22/h7-14,16-18,24H,6,15H2,1-5H3.
What are the key properties of 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-6-ethyl-2-methoxy-3,4,5-trimethyloxane?
2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-6-ethyl-2-methoxy-3,4,5-trimethyloxane has a molecular weight of 426.60 g/mol, XLogP of 7.15, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-6-ethyl-2-methoxy-3,4,5-trimethyloxane is sourced from PubChem (CID 59281662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).