C22H24N2O9 — CID 59282666
N-[2-[2-[2-[2-[(3,4-dioxocyclohexa-1,5-diene-1-carbonyl)amino]ethoxy]ethoxy]ethoxy]ethyl]-3,4-dioxocyclohexa-1,5-diene-1-carboxamide (PubChem CID 59282666) has the molecular formula C22H24N2O9 and a molecular weight of 460.44 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[(3,4-dioxocyclohexa-1,5-diene-1-carbonyl)amino]ethoxy]ethoxy]ethoxy]ethyl]-3,4-dioxocyclohexa-1,5-diene-1-carboxamide.
| Compound Name | N-[2-[2-[2-[2-[(3,4-dioxocyclohexa-1,5-diene-1-carbonyl)amino]ethoxy]ethoxy]ethoxy]ethyl]-3,4-dioxocyclohexa-1,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 59282666 |
| Molecular Formula | C22H24N2O9 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | N-[2-[2-[2-[2-[(3,4-dioxocyclohexa-1,5-diene-1-carbonyl)amino]ethoxy]ethoxy]ethoxy]ethyl]-3,4-dioxocyclohexa-1,5-diene-1-carboxamide |
| SMILES | O=C1C=CC(C(=O)NCCOCCOCCOCCNC(=O)C2=CC(=O)C(=O)C=C2)=CC1=O |
| InChI | InChI=1S/C22H24N2O9/c25-17-3-1-15(13-19(17)27)21(29)23-5-7-31-9-11-33-12-10-32-8-6-24-22(30)16-2-4-18(26)20(28)14-16/h1-4,13-14H,5-12H2,(H,23,29)(H,24,30) |
| InChIKey | OKXTWUJKDHEIDG-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 154.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|